Files
rgs/crates/core/flags/hiargs.rs
Peisong Xiao 0994661424
Some checks failed
ci / test (beta, ubuntu-latest, beta) (pull_request) Has been cancelled
ci / test (macos, macos-latest, nightly) (pull_request) Has been cancelled
ci / test (nightly, ubuntu-latest, nightly) (pull_request) Has been cancelled
ci / test (pinned, ubuntu-latest, 1.85.0) (pull_request) Has been cancelled
ci / test (stable, ubuntu-latest, stable) (pull_request) Has been cancelled
ci / test (stable-aarch64, ubuntu-latest, stable, aarch64-unknown-linux-gnu) (pull_request) Has been cancelled
ci / test (stable-arm-gnueabihf, ubuntu-latest, stable, armv7-unknown-linux-gnueabihf) (pull_request) Has been cancelled
ci / test (stable-arm-musleabi, ubuntu-latest, stable, armv7-unknown-linux-musleabi) (pull_request) Has been cancelled
ci / test (stable-arm-musleabihf, ubuntu-latest, stable, armv7-unknown-linux-musleabihf) (pull_request) Has been cancelled
ci / test (stable-musl, ubuntu-latest, stable, x86_64-unknown-linux-musl) (pull_request) Has been cancelled
ci / test (stable-powerpc64, ubuntu-latest, stable, powerpc64-unknown-linux-gnu) (pull_request) Has been cancelled
ci / test (stable-riscv64, ubuntu-latest, stable, riscv64gc-unknown-linux-gnu) (pull_request) Has been cancelled
ci / test (stable-s390x, ubuntu-latest, stable, s390x-unknown-linux-gnu) (pull_request) Has been cancelled
ci / test (stable-x86, ubuntu-latest, stable, i686-unknown-linux-gnu) (pull_request) Has been cancelled
ci / test (win-gnu, windows-latest, nightly-x86_64-gnu) (pull_request) Has been cancelled
ci / test (win-msvc, windows-latest, nightly) (pull_request) Has been cancelled
ci / test (winaarch64-msvc, windows-11-arm, nightly) (pull_request) Has been cancelled
ci / wasm (pull_request) Has been cancelled
ci / rustfmt (pull_request) Has been cancelled
ci / docs (pull_request) Has been cancelled
ci / Compile Fuzz Test Targets (pull_request) Has been cancelled
added docs and migrated name to rgs, migrated repo, added squash-lines feature
2026-01-13 20:35:39 -05:00

1490 lines
56 KiB
Rust

/*!
Provides the definition of high level arguments from CLI flags.
*/
use std::{
collections::HashSet,
path::{Path, PathBuf},
};
use {
bstr::BString,
grep::printer::{ColorSpecs, SquashMode, SummaryKind},
};
use crate::{
flags::lowargs::{
BinaryMode, BoundaryMode, BufferMode, CaseMode, ColorChoice,
ContextMode, ContextSeparator, EncodingMode, EngineChoice,
FieldContextSeparator, FieldMatchSeparator, LowArgs, MmapMode, Mode,
PatternSource, SearchMode, SortMode, SortModeKind, TypeChange,
},
haystack::{Haystack, HaystackBuilder},
search::{PatternMatcher, Printer, SearchWorker, SearchWorkerBuilder},
};
/// A high level representation of CLI arguments.
///
/// The distinction between low and high level arguments is somewhat arbitrary
/// and wishy washy. The main idea here is that high level arguments generally
/// require all of CLI parsing to be finished. For example, one cannot
/// construct a glob matcher until all of the glob patterns are known.
///
/// So while low level arguments are collected during parsing itself, high
/// level arguments aren't created until parsing has completely finished.
#[derive(Debug)]
pub(crate) struct HiArgs {
binary: BinaryDetection,
boundary: Option<BoundaryMode>,
buffer: BufferMode,
byte_offset: bool,
case: CaseMode,
color: ColorChoice,
colors: grep::printer::ColorSpecs,
column: bool,
context: ContextMode,
context_separator: ContextSeparator,
crlf: bool,
cwd: PathBuf,
dfa_size_limit: Option<usize>,
encoding: EncodingMode,
engine: EngineChoice,
field_context_separator: FieldContextSeparator,
field_match_separator: FieldMatchSeparator,
file_separator: Option<Vec<u8>>,
fixed_strings: bool,
follow: bool,
globs: ignore::overrides::Override,
heading: bool,
hidden: bool,
hyperlink_config: grep::printer::HyperlinkConfig,
ignore_file_case_insensitive: bool,
ignore_file: Vec<PathBuf>,
include_zero: bool,
in_file_index: bool,
invert_match: bool,
is_terminal_stdout: bool,
line_number: bool,
max_columns: Option<u64>,
max_columns_preview: bool,
max_count: Option<u64>,
max_depth: Option<usize>,
max_filesize: Option<u64>,
mmap_choice: grep::searcher::MmapChoice,
mode: Mode,
multiline: bool,
multiline_dotall: bool,
multiline_window: Option<usize>,
no_ignore_dot: bool,
no_ignore_exclude: bool,
no_ignore_files: bool,
no_ignore_global: bool,
no_ignore_parent: bool,
no_ignore_vcs: bool,
no_require_git: bool,
no_unicode: bool,
null_data: bool,
one_file_system: bool,
only_matching: bool,
path_separator: Option<u8>,
paths: Paths,
path_terminator: Option<u8>,
patterns: Patterns,
pre: Option<PathBuf>,
pre_globs: ignore::overrides::Override,
quiet: bool,
quit_after_match: bool,
regex_size_limit: Option<usize>,
replace: Option<BString>,
search_zip: bool,
sort: Option<SortMode>,
stats: Option<grep::printer::Stats>,
stop_on_nonmatch: bool,
squash: SquashMode,
threads: usize,
trim: bool,
types: ignore::types::Types,
vimgrep: bool,
with_filename: bool,
}
impl HiArgs {
/// Convert low level arguments into high level arguments.
///
/// This process can fail for a variety of reasons. For example, invalid
/// globs or some kind of environment issue.
pub(crate) fn from_low_args(mut low: LowArgs) -> anyhow::Result<HiArgs> {
// Callers should not be trying to convert low-level arguments when
// a short-circuiting special mode is present.
assert_eq!(None, low.special, "special mode demands short-circuiting");
// If the sorting mode isn't supported, then we bail loudly. I'm not
// sure if this is the right thing to do. We could silently "not sort"
// as well. If we wanted to go that route, then we could just set
// `low.sort = None` if `supported()` returns an error.
if let Some(ref sort) = low.sort {
sort.supported()?;
}
// We modify the mode in-place on `low` so that subsequent conversions
// see the correct mode.
match low.mode {
Mode::Search(ref mut mode) => match *mode {
// treat `-v --count-matches` as `-v --count`
SearchMode::CountMatches if low.invert_match => {
*mode = SearchMode::Count;
}
// treat `-o --count` as `--count-matches`
SearchMode::Count if low.only_matching => {
*mode = SearchMode::CountMatches;
}
_ => {}
},
_ => {}
}
let mut state = State::new()?;
let patterns = Patterns::from_low_args(&mut state, &mut low)?;
let paths = Paths::from_low_args(&mut state, &patterns, &mut low)?;
let binary = BinaryDetection::from_low_args(&state, &low);
let colors = take_color_specs(&mut state, &mut low);
let hyperlink_config = take_hyperlink_config(&mut state, &mut low)?;
let stats = stats(&low);
let types = types(&low)?;
let globs = globs(&state, &low)?;
let pre_globs = preprocessor_globs(&state, &low)?;
let color = match low.color {
ColorChoice::Auto if !state.is_terminal_stdout => {
ColorChoice::Never
}
_ => low.color,
};
let column = low.column.unwrap_or(low.vimgrep);
let heading = match low.heading {
None => !low.vimgrep && state.is_terminal_stdout,
Some(false) => false,
Some(true) => !low.vimgrep,
};
let path_terminator = if low.null { Some(b'\x00') } else { None };
let quit_after_match = stats.is_none() && low.quiet;
let threads = if low.sort.is_some() || paths.is_one_file {
1
} else if let Some(threads) = low.threads {
threads
} else {
std::thread::available_parallelism().map_or(1, |n| n.get()).min(12)
};
log::debug!("using {threads} thread(s)");
let with_filename = low
.with_filename
.unwrap_or_else(|| low.vimgrep || !paths.is_one_file);
let file_separator = match low.mode {
Mode::Search(SearchMode::Standard) => {
if heading {
Some(b"".to_vec())
} else if let ContextMode::Limited(ref limited) = low.context {
let (before, after) = limited.get();
if before > 0 || after > 0 {
low.context_separator.clone().into_bytes()
} else {
None
}
} else {
None
}
}
_ => None,
};
let line_number = low.line_number.unwrap_or_else(|| {
if low.quiet {
return false;
}
let Mode::Search(ref search_mode) = low.mode else { return false };
match *search_mode {
SearchMode::FilesWithMatches
| SearchMode::FilesWithoutMatch
| SearchMode::Count
| SearchMode::CountMatches => return false,
SearchMode::JSON => return true,
SearchMode::Standard => {
// A few things can imply counting line numbers. In
// particular, we generally want to show line numbers by
// default when printing to a tty for human consumption,
// except for one interesting case: when we're only
// searching stdin. This makes pipelines work as expected.
(state.is_terminal_stdout && !paths.is_only_stdin())
|| column
|| low.vimgrep
}
}
});
let mmap_choice = {
// SAFETY: Memory maps are difficult to impossible to encapsulate
// safely in a portable way that doesn't simultaneously negate some
// of the benfits of using memory maps. For ripgrep's use, we never
// mutate a memory map and generally never store the contents of
// memory map in a data structure that depends on immutability.
// Generally speaking, the worst thing that can happen is a SIGBUS
// (if the underlying file is truncated while reading it), which
// will cause ripgrep to abort. This reasoning should be treated as
// suspect.
let maybe = unsafe { grep::searcher::MmapChoice::auto() };
let never = grep::searcher::MmapChoice::never();
match low.mmap {
MmapMode::Auto => {
if paths.paths.len() <= 10
&& paths.paths.iter().all(|p| p.is_file())
{
// If we're only searching a few paths and all of them
// are files, then memory maps are probably faster.
maybe
} else {
never
}
}
MmapMode::AlwaysTryMmap => maybe,
MmapMode::Never => never,
}
};
Ok(HiArgs {
mode: low.mode,
patterns,
paths,
binary,
boundary: low.boundary,
buffer: low.buffer,
byte_offset: low.byte_offset,
case: low.case,
color,
colors,
column,
context: low.context,
context_separator: low.context_separator,
crlf: low.crlf,
cwd: state.cwd,
dfa_size_limit: low.dfa_size_limit,
encoding: low.encoding,
engine: low.engine,
field_context_separator: low.field_context_separator,
field_match_separator: low.field_match_separator,
file_separator,
fixed_strings: low.fixed_strings,
follow: low.follow,
heading,
hidden: low.hidden,
hyperlink_config,
ignore_file: low.ignore_file,
ignore_file_case_insensitive: low.ignore_file_case_insensitive,
include_zero: low.include_zero,
in_file_index: low.in_file_index,
invert_match: low.invert_match,
is_terminal_stdout: state.is_terminal_stdout,
line_number,
max_columns: low.max_columns,
max_columns_preview: low.max_columns_preview,
max_count: low.max_count,
max_depth: low.max_depth,
max_filesize: low.max_filesize,
mmap_choice,
multiline: low.multiline,
multiline_dotall: low.multiline_dotall,
multiline_window: low.multiline_window,
no_ignore_dot: low.no_ignore_dot,
no_ignore_exclude: low.no_ignore_exclude,
no_ignore_files: low.no_ignore_files,
no_ignore_global: low.no_ignore_global,
no_ignore_parent: low.no_ignore_parent,
no_ignore_vcs: low.no_ignore_vcs,
no_require_git: low.no_require_git,
no_unicode: low.no_unicode,
null_data: low.null_data,
one_file_system: low.one_file_system,
only_matching: low.only_matching,
globs,
path_separator: low.path_separator,
path_terminator,
pre: low.pre,
pre_globs,
quiet: low.quiet,
quit_after_match,
regex_size_limit: low.regex_size_limit,
replace: low.replace,
search_zip: low.search_zip,
sort: low.sort,
stats,
stop_on_nonmatch: low.stop_on_nonmatch,
squash: low.squash,
threads,
trim: low.trim,
types,
vimgrep: low.vimgrep,
with_filename,
})
}
/// Returns a writer for printing buffers to stdout.
///
/// This is intended to be used from multiple threads. Namely, a buffer
/// writer can create new buffers that are sent to threads. Threads can
/// then independently write to the buffers. Once a unit of work is
/// complete, a buffer can be given to the buffer writer to write to
/// stdout.
pub(crate) fn buffer_writer(&self) -> termcolor::BufferWriter {
let mut wtr =
termcolor::BufferWriter::stdout(self.color.to_termcolor());
wtr.separator(self.file_separator.clone());
wtr
}
/// Returns true when ripgrep had to guess to search the current working
/// directory. That is, it's true when ripgrep is called without any file
/// paths or directories to search.
///
/// Other than changing how file paths are printed (i.e., without the
/// leading `./`), it's also useful to know for diagnostic reasons. For
/// example, ripgrep will print an error message when nothing is searched
/// since it's possible the ignore rules in play are too aggressive. But
/// this warning is only emitted when ripgrep was called without any
/// explicit file paths since otherwise the warning would likely be too
/// aggressive.
pub(crate) fn has_implicit_path(&self) -> bool {
self.paths.has_implicit_path
}
/// Return a properly configured builder for constructing haystacks.
///
/// The builder can be used to turn a directory entry (from the `ignore`
/// crate) into something that can be searched.
pub(crate) fn haystack_builder(&self) -> HaystackBuilder {
let mut builder = HaystackBuilder::new();
builder.strip_dot_prefix(self.paths.has_implicit_path);
builder
}
/// Return the matcher that should be used for searching using the engine
/// choice made by the user.
///
/// If there was a problem building the matcher (e.g., a syntax error),
/// then this returns an error.
pub(crate) fn matcher(&self) -> anyhow::Result<PatternMatcher> {
match self.engine {
EngineChoice::Default => match self.matcher_rust() {
Ok(m) => Ok(m),
Err(err) => {
anyhow::bail!(suggest_other_engine(err.to_string()));
}
},
EngineChoice::PCRE2 => Ok(self.matcher_pcre2()?),
EngineChoice::Auto => {
let rust_err = match self.matcher_rust() {
Ok(m) => return Ok(m),
Err(err) => err,
};
log::debug!(
"error building Rust regex in hybrid mode:\n{rust_err}",
);
let pcre_err = match self.matcher_pcre2() {
Ok(m) => return Ok(m),
Err(err) => err,
};
let divider = "~".repeat(79);
anyhow::bail!(
"regex could not be compiled with either the default \
regex engine or with PCRE2.\n\n\
default regex engine error:\n\
{divider}\n\
{rust_err}\n\
{divider}\n\n\
PCRE2 regex engine error:\n{pcre_err}",
);
}
}
}
/// Build a matcher using PCRE2.
///
/// If there was a problem building the matcher (such as a regex syntax
/// error), then an error is returned.
///
/// If the `pcre2` feature is not enabled then this always returns an
/// error.
fn matcher_pcre2(&self) -> anyhow::Result<PatternMatcher> {
#[cfg(feature = "pcre2")]
{
let mut builder = grep::pcre2::RegexMatcherBuilder::new();
builder.multi_line(true).fixed_strings(self.fixed_strings);
match self.case {
CaseMode::Sensitive => builder.caseless(false),
CaseMode::Insensitive => builder.caseless(true),
CaseMode::Smart => builder.case_smart(true),
};
if let Some(ref boundary) = self.boundary {
match *boundary {
BoundaryMode::Line => builder.whole_line(true),
BoundaryMode::Word => builder.word(true),
};
}
// For whatever reason, the JIT craps out during regex compilation with
// a "no more memory" error on 32 bit systems. So don't use it there.
if cfg!(target_pointer_width = "64") {
builder
.jit_if_available(true)
// The PCRE2 docs say that 32KB is the default, and that 1MB
// should be big enough for anything. But let's crank it to
// 10MB.
.max_jit_stack_size(Some(10 * (1 << 20)));
}
if !self.no_unicode {
builder.utf(true).ucp(true);
}
if self.multiline {
builder.dotall(self.multiline_dotall);
}
if self.crlf {
builder.crlf(true);
}
let m = builder.build_many(&self.patterns.patterns)?;
Ok(PatternMatcher::PCRE2(m))
}
#[cfg(not(feature = "pcre2"))]
{
Err(anyhow::anyhow!(
"PCRE2 is not available in this build of ripgrep"
))
}
}
/// Build a matcher using Rust's regex engine.
///
/// If there was a problem building the matcher (such as a regex syntax
/// error), then an error is returned.
fn matcher_rust(&self) -> anyhow::Result<PatternMatcher> {
let mut builder = grep::regex::RegexMatcherBuilder::new();
builder
.multi_line(true)
.unicode(!self.no_unicode)
.octal(false)
.fixed_strings(self.fixed_strings);
match self.case {
CaseMode::Sensitive => builder.case_insensitive(false),
CaseMode::Insensitive => builder.case_insensitive(true),
CaseMode::Smart => builder.case_smart(true),
};
if let Some(ref boundary) = self.boundary {
match *boundary {
BoundaryMode::Line => builder.whole_line(true),
BoundaryMode::Word => builder.word(true),
};
}
if self.multiline {
builder.dot_matches_new_line(self.multiline_dotall);
if self.crlf {
builder.crlf(true).line_terminator(None);
}
} else {
builder.line_terminator(Some(b'\n')).dot_matches_new_line(false);
if self.crlf {
builder.crlf(true);
}
// We don't need to set this in multiline mode since multiline
// matchers don't use optimizations related to line terminators.
// Moreover, a multiline regex used with --null-data should
// be allowed to match NUL bytes explicitly, which this would
// otherwise forbid.
if self.null_data {
builder.line_terminator(Some(b'\x00'));
}
}
if let Some(limit) = self.regex_size_limit {
builder.size_limit(limit);
}
if let Some(limit) = self.dfa_size_limit {
builder.dfa_size_limit(limit);
}
if !self.binary.is_none() {
builder.ban_byte(Some(b'\x00'));
}
let m = match builder.build_many(&self.patterns.patterns) {
Ok(m) => m,
Err(err) => {
anyhow::bail!(suggest_text(suggest_multiline(err.to_string())))
}
};
Ok(PatternMatcher::RustRegex(m))
}
/// Returns true if some non-zero number of matches is believed to be
/// possible.
///
/// When this returns false, it is impossible for ripgrep to ever report
/// a match.
pub(crate) fn matches_possible(&self) -> bool {
if self.patterns.patterns.is_empty() && !self.invert_match {
return false;
}
if self.max_count == Some(0) {
return false;
}
true
}
/// Returns the "mode" that ripgrep should operate in.
///
/// This is generally useful for determining what action ripgrep should
/// take. The main mode is of course to "search," but there are other
/// non-search modes such as `--type-list` and `--files`.
pub(crate) fn mode(&self) -> Mode {
self.mode
}
/// Returns a builder for constructing a "path printer."
///
/// This is useful for the `--files` mode in ripgrep, where the printer
/// just needs to emit paths and not need to worry about the functionality
/// of searching.
pub(crate) fn path_printer_builder(
&self,
) -> grep::printer::PathPrinterBuilder {
let mut builder = grep::printer::PathPrinterBuilder::new();
builder
.color_specs(self.colors.clone())
.hyperlink(self.hyperlink_config.clone())
.separator(self.path_separator.clone())
.terminator(self.path_terminator.unwrap_or(b'\n'));
builder
}
/// Returns a printer for the given search mode.
///
/// This chooses which printer to build (JSON, summary or standard) based
/// on the search mode given.
pub(crate) fn printer<W: termcolor::WriteColor>(
&self,
search_mode: SearchMode,
wtr: W,
) -> Printer<W> {
let summary_kind = if self.quiet {
match search_mode {
SearchMode::FilesWithMatches
| SearchMode::Count
| SearchMode::CountMatches
| SearchMode::JSON
| SearchMode::Standard => SummaryKind::QuietWithMatch,
SearchMode::FilesWithoutMatch => {
SummaryKind::QuietWithoutMatch
}
}
} else {
match search_mode {
SearchMode::FilesWithMatches => SummaryKind::PathWithMatch,
SearchMode::FilesWithoutMatch => SummaryKind::PathWithoutMatch,
SearchMode::Count => SummaryKind::Count,
SearchMode::CountMatches => SummaryKind::CountMatches,
SearchMode::JSON => {
return Printer::JSON(self.printer_json(wtr));
}
SearchMode::Standard => {
return Printer::Standard(self.printer_standard(wtr));
}
}
};
Printer::Summary(self.printer_summary(wtr, summary_kind))
}
/// Builds a JSON printer.
fn printer_json<W: std::io::Write>(
&self,
wtr: W,
) -> grep::printer::JSON<W> {
grep::printer::JSONBuilder::new()
.pretty(false)
.always_begin_end(false)
.replacement(self.replace.clone().map(|r| r.into()))
.build(wtr)
}
/// Builds a "standard" grep printer where matches are printed as plain
/// text lines.
fn printer_standard<W: termcolor::WriteColor>(
&self,
wtr: W,
) -> grep::printer::Standard<W> {
let mut builder = grep::printer::StandardBuilder::new();
builder
.byte_offset(self.byte_offset)
.color_specs(self.colors.clone())
.column(self.column)
.heading(self.heading)
.hyperlink(self.hyperlink_config.clone())
.in_file_index(self.in_file_index)
.max_columns_preview(self.max_columns_preview)
.max_columns(self.max_columns)
.only_matching(self.only_matching)
.path(self.with_filename)
.path_terminator(self.path_terminator.clone())
.per_match_one_line(true)
.per_match(self.vimgrep)
.replacement(self.replace.clone().map(|r| r.into()))
.squash(self.squash)
.separator_context(self.context_separator.clone().into_bytes())
.separator_field_context(
self.field_context_separator.clone().into_bytes(),
)
.separator_field_match(
self.field_match_separator.clone().into_bytes(),
)
.separator_path(self.path_separator.clone())
.stats(self.stats.is_some())
.trim_ascii(self.trim);
// When doing multi-threaded searching, the buffer writer is
// responsible for writing separators since it is the only thing that
// knows whether something has been printed or not. But for the single
// threaded case, we don't use a buffer writer and thus can let the
// printer own this.
if self.threads == 1 {
builder.separator_search(self.file_separator.clone());
}
builder.build(wtr)
}
/// Builds a "summary" printer where search results are aggregated on a
/// file-by-file basis.
fn printer_summary<W: termcolor::WriteColor>(
&self,
wtr: W,
kind: SummaryKind,
) -> grep::printer::Summary<W> {
grep::printer::SummaryBuilder::new()
.color_specs(self.colors.clone())
.exclude_zero(!self.include_zero)
.hyperlink(self.hyperlink_config.clone())
.kind(kind)
.path(self.with_filename)
.path_terminator(self.path_terminator.clone())
.separator_field(b":".to_vec())
.separator_path(self.path_separator.clone())
.stats(self.stats.is_some())
.build(wtr)
}
/// Returns true if ripgrep should operate in "quiet" mode.
///
/// Generally speaking, quiet mode means that ripgrep should not print
/// anything to stdout. There are some exceptions. For example, when the
/// user has provided `--stats`, then ripgrep will print statistics to
/// stdout.
pub(crate) fn quiet(&self) -> bool {
self.quiet
}
/// Returns true when ripgrep should stop searching after a single match is
/// found.
///
/// This is useful for example when quiet mode is enabled. In that case,
/// users generally can't tell the difference in behavior between a search
/// that finds all matches and a search that only finds one of them. (An
/// exception here is if `--stats` is given, then `quit_after_match` will
/// always return false since the user expects ripgrep to find everything.)
pub(crate) fn quit_after_match(&self) -> bool {
self.quit_after_match
}
/// Build a worker for executing searches.
///
/// Search results are found using the given matcher and written to the
/// given printer.
pub(crate) fn search_worker<W: termcolor::WriteColor>(
&self,
matcher: PatternMatcher,
searcher: grep::searcher::Searcher,
printer: Printer<W>,
) -> anyhow::Result<SearchWorker<W>> {
let mut builder = SearchWorkerBuilder::new();
builder
.preprocessor(self.pre.clone())?
.preprocessor_globs(self.pre_globs.clone())
.search_zip(self.search_zip)
.binary_detection_explicit(self.binary.explicit.clone())
.binary_detection_implicit(self.binary.implicit.clone());
Ok(builder.build(matcher, searcher, printer))
}
/// Build a searcher from the command line parameters.
pub(crate) fn searcher(&self) -> anyhow::Result<grep::searcher::Searcher> {
let line_term = if self.crlf {
grep::matcher::LineTerminator::crlf()
} else if self.null_data {
grep::matcher::LineTerminator::byte(b'\x00')
} else {
grep::matcher::LineTerminator::byte(b'\n')
};
let mut builder = grep::searcher::SearcherBuilder::new();
builder
.max_matches(self.max_count)
.line_terminator(line_term)
.invert_match(self.invert_match)
.line_number(self.line_number)
.multi_line(self.multiline)
.multiline_window(self.multiline_window)
.memory_map(self.mmap_choice.clone())
.stop_on_nonmatch(self.stop_on_nonmatch);
match self.context {
ContextMode::Passthru => {
builder.passthru(true);
}
ContextMode::Limited(ref limited) => {
let (before, after) = limited.get();
builder.before_context(before);
builder.after_context(after);
}
}
match self.encoding {
EncodingMode::Auto => {} // default for the searcher
EncodingMode::Some(ref enc) => {
builder.encoding(Some(enc.clone()));
}
EncodingMode::Disabled => {
builder.bom_sniffing(false);
}
}
Ok(builder.build())
}
/// Given an iterator of haystacks, sort them if necessary.
///
/// When sorting is necessary, this will collect the entire iterator into
/// memory, sort them and then return a new iterator. When sorting is not
/// necessary, then the iterator given is returned as is without collecting
/// it into memory.
///
/// Once special case is when sorting by path in ascending order has been
/// requested. In this case, the iterator given is returned as is without
/// any additional sorting. This is done because `walk_builder()` will sort
/// the iterator it yields during directory traversal, so no additional
/// sorting is needed.
pub(crate) fn sort<'a, I>(
&self,
haystacks: I,
) -> Box<dyn Iterator<Item = Haystack> + 'a>
where
I: Iterator<Item = Haystack> + 'a,
{
use std::{cmp::Ordering, fs::Metadata, io, time::SystemTime};
fn attach_timestamps(
haystacks: impl Iterator<Item = Haystack>,
get: impl Fn(&Metadata) -> io::Result<SystemTime>,
) -> impl Iterator<Item = (Haystack, Option<SystemTime>)> {
haystacks.map(move |s| {
let time = s.path().metadata().and_then(|m| get(&m)).ok();
(s, time)
})
}
let Some(ref sort) = self.sort else { return Box::new(haystacks) };
let mut with_timestamps: Vec<_> = match sort.kind {
SortModeKind::Path if !sort.reverse => return Box::new(haystacks),
SortModeKind::Path => {
let mut haystacks = haystacks.collect::<Vec<Haystack>>();
haystacks.sort_by(|ref h1, ref h2| {
h1.path().cmp(h2.path()).reverse()
});
return Box::new(haystacks.into_iter());
}
SortModeKind::LastModified => {
attach_timestamps(haystacks, |md| md.modified()).collect()
}
SortModeKind::LastAccessed => {
attach_timestamps(haystacks, |md| md.accessed()).collect()
}
SortModeKind::Created => {
attach_timestamps(haystacks, |md| md.created()).collect()
}
};
with_timestamps.sort_by(|(_, t1), (_, t2)| {
let ordering = match (*t1, *t2) {
// Both have metadata, do the obvious thing.
(Some(t1), Some(t2)) => t1.cmp(&t2),
// Things that error should appear later (when ascending).
(Some(_), None) => Ordering::Less,
// Things that error should appear later (when ascending).
(None, Some(_)) => Ordering::Greater,
// When both error, we can't distinguish, so treat as equal.
(None, None) => Ordering::Equal,
};
if sort.reverse { ordering.reverse() } else { ordering }
});
Box::new(with_timestamps.into_iter().map(|(s, _)| s))
}
/// Returns a stats object if the user requested that ripgrep keep track
/// of various metrics during a search.
///
/// When this returns `None`, then callers may assume that the user did
/// not request statistics.
pub(crate) fn stats(&self) -> Option<grep::printer::Stats> {
self.stats.clone()
}
/// Returns a color-enabled writer for stdout.
///
/// The writer returned is also configured to do either line or block
/// buffering, based on either explicit configuration from the user via CLI
/// flags, or automatically based on whether stdout is connected to a tty.
pub(crate) fn stdout(&self) -> grep::cli::StandardStream {
let color = self.color.to_termcolor();
match self.buffer {
BufferMode::Auto => {
if self.is_terminal_stdout {
grep::cli::stdout_buffered_line(color)
} else {
grep::cli::stdout_buffered_block(color)
}
}
BufferMode::Line => grep::cli::stdout_buffered_line(color),
BufferMode::Block => grep::cli::stdout_buffered_block(color),
}
}
/// Returns the total number of threads ripgrep should use to execute a
/// search.
///
/// This number is the result of reasoning about both heuristics (like
/// the available number of cores) and whether ripgrep's mode supports
/// parallelism. It is intended that this number be used to directly
/// determine how many threads to spawn.
pub(crate) fn threads(&self) -> usize {
self.threads
}
/// Returns the file type matcher that was built.
///
/// The matcher includes both the default rules and any rules added by the
/// user for this specific invocation.
pub(crate) fn types(&self) -> &ignore::types::Types {
&self.types
}
/// Create a new builder for recursive directory traversal.
///
/// The builder returned can be used to start a single threaded or multi
/// threaded directory traversal. For multi threaded traversal, the number
/// of threads configured is equivalent to `HiArgs::threads`.
///
/// If `HiArgs::threads` is equal to `1`, then callers should generally
/// choose to explicitly use single threaded traversal since it won't have
/// the unnecessary overhead of synchronization.
pub(crate) fn walk_builder(&self) -> anyhow::Result<ignore::WalkBuilder> {
let mut builder = ignore::WalkBuilder::new(&self.paths.paths[0]);
for path in self.paths.paths.iter().skip(1) {
builder.add(path);
}
if !self.no_ignore_files {
for path in self.ignore_file.iter() {
if let Some(err) = builder.add_ignore(path) {
ignore_message!("{err}");
}
}
}
builder
.max_depth(self.max_depth)
.follow_links(self.follow)
.max_filesize(self.max_filesize)
.threads(self.threads)
.same_file_system(self.one_file_system)
.skip_stdout(matches!(self.mode, Mode::Search(_)))
.overrides(self.globs.clone())
.types(self.types.clone())
.hidden(!self.hidden)
.parents(!self.no_ignore_parent)
.ignore(!self.no_ignore_dot)
.git_global(!self.no_ignore_vcs && !self.no_ignore_global)
.git_ignore(!self.no_ignore_vcs)
.git_exclude(!self.no_ignore_vcs && !self.no_ignore_exclude)
.require_git(!self.no_require_git)
.ignore_case_insensitive(self.ignore_file_case_insensitive)
.current_dir(&self.cwd);
if !self.no_ignore_dot {
builder.add_custom_ignore_filename(".rgignore");
}
// When we want to sort paths lexicographically in ascending order,
// then we can actually do this during directory traversal itself.
// Otherwise, sorting is done by collecting all paths, sorting them and
// then searching them.
if let Some(ref sort) = self.sort {
assert_eq!(1, self.threads, "sorting implies single threaded");
if !sort.reverse && matches!(sort.kind, SortModeKind::Path) {
builder.sort_by_file_name(|a, b| a.cmp(b));
}
}
Ok(builder)
}
}
/// State that only needs to be computed once during argument parsing.
///
/// This state is meant to be somewhat generic and shared across multiple
/// low->high argument conversions. The state can even be mutated by various
/// conversions as a way to communicate changes to other conversions. For
/// example, reading patterns might consume from stdin. If we know stdin
/// has been consumed and no other file paths have been given, then we know
/// for sure that we should search the CWD. In this way, a state change
/// when reading the patterns can impact how the file paths are ultimately
/// generated.
#[derive(Debug)]
struct State {
/// Whether it's believed that tty is connected to stdout. Note that on
/// unix systems, this is always correct. On Windows, heuristics are used
/// by Rust's standard library, particularly for cygwin/MSYS environments.
is_terminal_stdout: bool,
/// Whether stdin has already been consumed. This is useful to know and for
/// providing good error messages when the user has tried to read from stdin
/// in two different places. For example, `rg -f - -`.
stdin_consumed: bool,
/// The current working directory.
cwd: PathBuf,
}
impl State {
/// Initialize state to some sensible defaults.
///
/// Note that the state values may change throughout the lifetime of
/// argument parsing.
fn new() -> anyhow::Result<State> {
use std::io::IsTerminal;
let cwd = current_dir()?;
log::debug!("read CWD from environment: {}", cwd.display());
Ok(State {
is_terminal_stdout: std::io::stdout().is_terminal(),
stdin_consumed: false,
cwd,
})
}
}
/// The disjunction of patterns to search for.
///
/// The number of patterns can be empty, e.g., via `-f /dev/null`.
#[derive(Debug)]
struct Patterns {
/// The actual patterns to match.
patterns: Vec<String>,
}
impl Patterns {
/// Pulls the patterns out of the low arguments.
///
/// This includes collecting patterns from -e/--regexp and -f/--file.
///
/// If the invocation implies that the first positional argument is a
/// pattern (the common case), then the first positional argument is
/// extracted as well.
fn from_low_args(
state: &mut State,
low: &mut LowArgs,
) -> anyhow::Result<Patterns> {
// The first positional is only a pattern when ripgrep is instructed to
// search and neither -e/--regexp nor -f/--file is given. Basically,
// the first positional is a pattern only when a pattern hasn't been
// given in some other way.
// No search means no patterns. Even if -e/--regexp or -f/--file is
// given, we know we won't use them so don't bother collecting them.
if !matches!(low.mode, Mode::Search(_)) {
return Ok(Patterns { patterns: vec![] });
}
// If we got nothing from -e/--regexp and -f/--file, then the first
// positional is a pattern.
if low.patterns.is_empty() {
anyhow::ensure!(
!low.positional.is_empty(),
"ripgrep requires at least one pattern to execute a search"
);
let ospat = low.positional.remove(0);
let Ok(pat) = ospat.into_string() else {
anyhow::bail!("pattern given is not valid UTF-8")
};
return Ok(Patterns { patterns: vec![pat] });
}
// Otherwise, we need to slurp up our patterns from -e/--regexp and
// -f/--file. We de-duplicate as we go. If we don't de-duplicate,
// then it can actually lead to major slow downs for sloppy inputs.
// This might be surprising, and the regex engine will eventually
// de-duplicate duplicative branches in a single regex (maybe), but
// not until after it has gone through parsing and some other layers.
// If there are a lot of duplicates, then that can lead to a sizeable
// extra cost. It is lamentable that we pay the extra cost here to
// de-duplicate for a likely uncommon case, but I've seen this have a
// big impact on real world data.
let mut seen = HashSet::new();
let mut patterns = Vec::with_capacity(low.patterns.len());
let mut add = |pat: String| {
if !seen.contains(&pat) {
seen.insert(pat.clone());
patterns.push(pat);
}
};
for source in low.patterns.drain(..) {
match source {
PatternSource::Regexp(pat) => add(pat),
PatternSource::File(path) => {
if path == Path::new("-") {
anyhow::ensure!(
!state.stdin_consumed,
"error reading -f/--file from stdin: stdin \
has already been consumed"
);
for pat in grep::cli::patterns_from_stdin()? {
add(pat);
}
state.stdin_consumed = true;
} else {
for pat in grep::cli::patterns_from_path(&path)? {
add(pat);
}
}
}
}
}
Ok(Patterns { patterns })
}
}
/// The collection of paths we want to search for.
///
/// This guarantees that there is always at least one path.
#[derive(Debug)]
struct Paths {
/// The actual paths.
paths: Vec<PathBuf>,
/// This is true when ripgrep had to guess to search the current working
/// directory. e.g., When the user just runs `rg foo`. It is odd to need
/// this, but it subtly changes how the paths are printed. When no explicit
/// path is given, then ripgrep doesn't prefix each path with `./`. But
/// otherwise it does! This curious behavior matches what GNU grep does.
has_implicit_path: bool,
/// Set to true if it is known that only a single file descriptor will
/// be searched.
is_one_file: bool,
}
impl Paths {
/// Drain the search paths out of the given low arguments.
fn from_low_args(
state: &mut State,
_: &Patterns,
low: &mut LowArgs,
) -> anyhow::Result<Paths> {
// We require a `&Patterns` even though we don't use it to ensure that
// patterns have already been read from LowArgs. This let's us safely
// assume that all remaining positional arguments are intended to be
// file paths.
let mut paths = Vec::with_capacity(low.positional.len());
for osarg in low.positional.drain(..) {
let path = PathBuf::from(osarg);
if state.stdin_consumed && path == Path::new("-") {
anyhow::bail!(
"error: attempted to read patterns from stdin \
while also searching stdin",
);
}
paths.push(path);
}
log::debug!("number of paths given to search: {}", paths.len());
if !paths.is_empty() {
let is_one_file = paths.len() == 1
// Note that we specifically use `!paths[0].is_dir()` here
// instead of `paths[0].is_file()`. Namely, the latter can
// return `false` even when the path is something resembling
// a file. So instead, we just consider the path a file as
// long as we know it isn't a directory.
//
// See: https://github.com/BurntSushi/ripgrep/issues/2736
&& (paths[0] == Path::new("-") || !paths[0].is_dir());
log::debug!("is_one_file? {is_one_file:?}");
return Ok(Paths { paths, has_implicit_path: false, is_one_file });
}
// N.B. is_readable_stdin is a heuristic! Part of the issue is that a
// lot of "exec process" APIs will open a stdin pipe even though stdin
// isn't really being used. ripgrep then thinks it should search stdin
// and one gets the appearance of it hanging. It's a terrible failure
// mode, but there really is no good way to mitigate it. It's just a
// consequence of letting the user type 'rg foo' and "guessing" that
// they meant to search the CWD.
let is_readable_stdin = grep::cli::is_readable_stdin();
let use_cwd = !is_readable_stdin
|| state.stdin_consumed
|| !matches!(low.mode, Mode::Search(_));
log::debug!(
"using heuristics to determine whether to read from \
stdin or search ./ (\
is_readable_stdin={is_readable_stdin}, \
stdin_consumed={stdin_consumed}, \
mode={mode:?})",
stdin_consumed = state.stdin_consumed,
mode = low.mode,
);
let (path, is_one_file) = if use_cwd {
log::debug!("heuristic chose to search ./");
(PathBuf::from("./"), false)
} else {
log::debug!("heuristic chose to search stdin");
(PathBuf::from("-"), true)
};
Ok(Paths { paths: vec![path], has_implicit_path: true, is_one_file })
}
/// Returns true if ripgrep will only search stdin and nothing else.
fn is_only_stdin(&self) -> bool {
self.paths.len() == 1 && self.paths[0] == Path::new("-")
}
}
/// The "binary detection" configuration that ripgrep should use.
///
/// ripgrep actually uses two different binary detection heuristics depending
/// on whether a file is explicitly being searched (e.g., via a CLI argument)
/// or implicitly searched (e.g., via directory traversal). In general, the
/// former can never use a heuristic that lets it "quit" seaching before
/// either getting EOF or finding a match. (Because doing otherwise would be
/// considered a filter, and ripgrep follows the rule that an explicitly given
/// file is always searched.)
#[derive(Debug)]
struct BinaryDetection {
explicit: grep::searcher::BinaryDetection,
implicit: grep::searcher::BinaryDetection,
}
impl BinaryDetection {
/// Determines the correct binary detection mode from low-level arguments.
fn from_low_args(_: &State, low: &LowArgs) -> BinaryDetection {
let none = matches!(low.binary, BinaryMode::AsText) || low.null_data;
let convert = matches!(low.binary, BinaryMode::SearchAndSuppress);
let explicit = if none {
grep::searcher::BinaryDetection::none()
} else {
grep::searcher::BinaryDetection::convert(b'\x00')
};
let implicit = if none {
grep::searcher::BinaryDetection::none()
} else if convert {
grep::searcher::BinaryDetection::convert(b'\x00')
} else {
grep::searcher::BinaryDetection::quit(b'\x00')
};
BinaryDetection { explicit, implicit }
}
/// Returns true when both implicit and explicit binary detection is
/// disabled.
pub(crate) fn is_none(&self) -> bool {
let none = grep::searcher::BinaryDetection::none();
self.explicit == none && self.implicit == none
}
}
/// Builds the file type matcher from low level arguments.
fn types(low: &LowArgs) -> anyhow::Result<ignore::types::Types> {
let mut builder = ignore::types::TypesBuilder::new();
builder.add_defaults();
for tychange in low.type_changes.iter() {
match *tychange {
TypeChange::Clear { ref name } => {
builder.clear(name);
}
TypeChange::Add { ref def } => {
builder.add_def(def)?;
}
TypeChange::Select { ref name } => {
builder.select(name);
}
TypeChange::Negate { ref name } => {
builder.negate(name);
}
}
}
Ok(builder.build()?)
}
/// Builds the glob "override" matcher from the CLI `-g/--glob` and `--iglob`
/// flags.
fn globs(
state: &State,
low: &LowArgs,
) -> anyhow::Result<ignore::overrides::Override> {
if low.globs.is_empty() && low.iglobs.is_empty() {
return Ok(ignore::overrides::Override::empty());
}
let mut builder = ignore::overrides::OverrideBuilder::new(&state.cwd);
// Make all globs case insensitive with --glob-case-insensitive.
if low.glob_case_insensitive {
builder.case_insensitive(true).unwrap();
}
for glob in low.globs.iter() {
builder.add(glob)?;
}
// This only enables case insensitivity for subsequent globs.
builder.case_insensitive(true).unwrap();
for glob in low.iglobs.iter() {
builder.add(&glob)?;
}
Ok(builder.build()?)
}
/// Builds a glob matcher for all of the preprocessor globs (via `--pre-glob`).
fn preprocessor_globs(
state: &State,
low: &LowArgs,
) -> anyhow::Result<ignore::overrides::Override> {
if low.pre_glob.is_empty() {
return Ok(ignore::overrides::Override::empty());
}
let mut builder = ignore::overrides::OverrideBuilder::new(&state.cwd);
for glob in low.pre_glob.iter() {
builder.add(glob)?;
}
Ok(builder.build()?)
}
/// Determines whether stats should be tracked for this search. If so, a stats
/// object is returned.
fn stats(low: &LowArgs) -> Option<grep::printer::Stats> {
if !matches!(low.mode, Mode::Search(_)) {
return None;
}
if low.stats || matches!(low.mode, Mode::Search(SearchMode::JSON)) {
return Some(grep::printer::Stats::new());
}
None
}
/// Pulls out any color specs provided by the user and assembles them into one
/// single configuration.
fn take_color_specs(_: &mut State, low: &mut LowArgs) -> ColorSpecs {
let mut specs = grep::printer::default_color_specs();
for spec in low.colors.drain(..) {
specs.push(spec);
}
ColorSpecs::new(&specs)
}
/// Pulls out the necessary info from the low arguments to build a full
/// hyperlink configuration.
fn take_hyperlink_config(
_: &mut State,
low: &mut LowArgs,
) -> anyhow::Result<grep::printer::HyperlinkConfig> {
let mut env = grep::printer::HyperlinkEnvironment::new();
if let Some(hostname) = hostname(low.hostname_bin.as_deref()) {
log::debug!("found hostname for hyperlink configuration: {hostname}");
env.host(Some(hostname));
}
if let Some(wsl_prefix) = wsl_prefix() {
log::debug!(
"found wsl_prefix for hyperlink configuration: {wsl_prefix}"
);
env.wsl_prefix(Some(wsl_prefix));
}
let fmt = std::mem::take(&mut low.hyperlink_format);
log::debug!("hyperlink format: {:?}", fmt.to_string());
Ok(grep::printer::HyperlinkConfig::new(env, fmt))
}
/// Attempts to discover the current working directory.
///
/// This mostly just defers to the standard library, however, such things will
/// fail if ripgrep is in a directory that no longer exists. We attempt some
/// fallback mechanisms, such as querying the PWD environment variable, but
/// otherwise return an error.
fn current_dir() -> anyhow::Result<PathBuf> {
let err = match std::env::current_dir() {
Err(err) => err,
Ok(cwd) => return Ok(cwd),
};
if let Some(cwd) = std::env::var_os("PWD") {
if !cwd.is_empty() {
return Ok(PathBuf::from(cwd));
}
}
anyhow::bail!(
"failed to get current working directory: {err}\n\
did your CWD get deleted?",
)
}
/// Retrieves the hostname that should be used wherever a hostname is required.
///
/// Currently, this is only used in the hyperlink format.
///
/// This works by first running the given binary program (if present and with
/// no arguments) to get the hostname after trimming leading and trailing
/// whitespace. If that fails for any reason, then it falls back to getting
/// the hostname via platform specific means (e.g., `gethostname` on Unix).
///
/// The purpose of `bin` is to make it possible for end users to override how
/// ripgrep determines the hostname.
fn hostname(bin: Option<&Path>) -> Option<String> {
let Some(bin) = bin else { return platform_hostname() };
let bin = match grep::cli::resolve_binary(bin) {
Ok(bin) => bin,
Err(err) => {
log::debug!(
"failed to run command '{bin:?}' to get hostname \
(falling back to platform hostname): {err}",
);
return platform_hostname();
}
};
let mut cmd = std::process::Command::new(&bin);
cmd.stdin(std::process::Stdio::null());
let rdr = match grep::cli::CommandReader::new(&mut cmd) {
Ok(rdr) => rdr,
Err(err) => {
log::debug!(
"failed to spawn command '{bin:?}' to get \
hostname (falling back to platform hostname): {err}",
);
return platform_hostname();
}
};
let out = match std::io::read_to_string(rdr) {
Ok(out) => out,
Err(err) => {
log::debug!(
"failed to read output from command '{bin:?}' to get \
hostname (falling back to platform hostname): {err}",
);
return platform_hostname();
}
};
let hostname = out.trim();
if hostname.is_empty() {
log::debug!(
"output from command '{bin:?}' is empty after trimming \
leading and trailing whitespace (falling back to \
platform hostname)",
);
return platform_hostname();
}
Some(hostname.to_string())
}
/// Attempts to get the hostname by using platform specific routines.
///
/// For example, this will do `gethostname` on Unix and `GetComputerNameExW` on
/// Windows.
fn platform_hostname() -> Option<String> {
let hostname_os = match grep::cli::hostname() {
Ok(x) => x,
Err(err) => {
log::debug!("could not get hostname: {}", err);
return None;
}
};
let Some(hostname) = hostname_os.to_str() else {
log::debug!(
"got hostname {:?}, but it's not valid UTF-8",
hostname_os
);
return None;
};
Some(hostname.to_string())
}
/// Returns the value for the `{wslprefix}` variable in a hyperlink format.
///
/// A WSL prefix is a share/network like thing that is meant to permit Windows
/// applications to open files stored within a WSL drive.
///
/// If a WSL distro name is unavailable, not valid UTF-8 or this isn't running
/// in a Unix environment, then this returns None.
///
/// See: <https://learn.microsoft.com/en-us/windows/wsl/filesystems>
fn wsl_prefix() -> Option<String> {
if !cfg!(unix) {
return None;
}
let distro_os = std::env::var_os("WSL_DISTRO_NAME")?;
let Some(distro) = distro_os.to_str() else {
log::debug!(
"found WSL_DISTRO_NAME={:?}, but value is not UTF-8",
distro_os
);
return None;
};
Some(format!("wsl$/{distro}"))
}
/// Possibly suggest another regex engine based on the error message given.
///
/// This inspects an error resulting from building a Rust regex matcher, and
/// if it's believed to correspond to a syntax error that another engine could
/// handle, then add a message to suggest the use of the engine flag.
fn suggest_other_engine(msg: String) -> String {
if let Some(pcre_msg) = suggest_pcre2(&msg) {
return pcre_msg;
}
msg
}
/// Possibly suggest PCRE2 based on the error message given.
///
/// Inspect an error resulting from building a Rust regex matcher, and if it's
/// believed to correspond to a syntax error that PCRE2 could handle, then
/// add a message to suggest the use of -P/--pcre2.
fn suggest_pcre2(msg: &str) -> Option<String> {
if !cfg!(feature = "pcre2") {
return None;
}
if !msg.contains("backreferences") && !msg.contains("look-around") {
None
} else {
Some(format!(
"{msg}
Consider enabling PCRE2 with the --pcre2 flag, which can handle backreferences
and look-around.",
))
}
}
/// Possibly suggest multiline mode based on the error message given.
///
/// Does a bit of a hacky inspection of the given error message, and if it
/// looks like the user tried to type a literal line terminator then it will
/// return a new error message suggesting the use of -U/--multiline.
fn suggest_multiline(msg: String) -> String {
if msg.contains("the literal") && msg.contains("not allowed") {
format!(
"{msg}
Consider enabling multiline mode with the --multiline flag (or -U for short).
When multiline mode is enabled, new line characters can be matched.",
)
} else {
msg
}
}
/// Possibly suggest the `-a/--text` flag.
fn suggest_text(msg: String) -> String {
if msg.contains("pattern contains \"\\0\"") {
format!(
"{msg}
Consider enabling text mode with the --text flag (or -a for short). Otherwise,
binary detection is enabled and matching a NUL byte is impossible.",
)
} else {
msg
}
}